Volatile complexes of Pd(II) with methoxy-β-iminoketones: Synthesis, properties, and crystal and molecular structure

Abstract

This paper describes a procedure for the synthesis of two new volatile complexes, Pd(L1)2 and Pd(L2)2, from sterically hindered methoxy-β-iminoketones, where HL1 = C(CH3)2(OCH3)-C(NH)-CH2-C(O)-C(CH3)3; HL2 = C(CH3)2(OCH3)-C(NH)-CH2-C(O)-CH(CH3)2. Element analysis and IR spectral data are given. The results of full X-ray crystal structure analysis of the complexes are reported. The compounds have molecular structures; the crystals of the complexes have different symmetry groups and unit cell dimensions. The Pd(L1)2 complex molecule has a nonplanar structure; the Pd(L2)2 complex has a cis-structure. The geometrical characteristics obtained for the coordination units are as follows: the Pd-O and Pd-N bond lengths and N-Pd-O chelate angles were estimated at 1.960 A, 93.7° for Pd(L1)2, and 1.984 A, 1.976 A, 92.4° for Pd(L2)2.