Abstract
A novel silver-containing compound bis-benzylamino-silver(I) benzylcarbamate with the molecular formula of C22H26N3O2Ag and structural formula of C6H5CH2NHCOOAg(NH2CH2C6H5)2 is synthesized by the reaction of benzylamonium benzylcarbamate and silver oxide. It crystallizes in triclinic crystal system and P-1 space group with a = 5.2006(5) A, b = 14.6298(15) A, c = 14.7246(15) A, α = 68.729(2)°, β = 83.507(2)°, γ = 85.412(2)°, and Z = 2. In the crystal, all of the silver atoms are two-coordinate, i.e., one silver atom symmetrically chelates with the two amino groups in two benzylamine molecules, while all the carboxylate groups only act as charge balancers. In addition, the crystal contains a large quantity of hydrogen bonds sustaining the stability of three-dimensional structure. A novel compound bis-benzylamino-silver(I) benzylcarbamate with a special molecular structure of two-coordinate is conveniently synthesized and it crystallizes in triclinic crystal system and P-1 space group with a = 5.2006(5) A, b = 14.6298(15) A, c = 14.7246(15) A, α = 68.729(2)°, β = 83.507(2)°, γ = 85.412(2)°, and Z = 2.
Sign-in/Register to access full text options 
Free) 
Talk to us
Join us for a 30 min session where you can share your feedback and ask us any queries you have
Schedule a call
