Reactions of phosphinoacetylenes with manganese and cobalt carbonyl compounds

Abstract

1. Reaction of CpMn(CO)2(THF) with Ph2PC≡ CR, where R=H, Ph gave the new complexes CpMn(CO)2PPh2C≡CR and CpMn(CO)2 (π-RC≡CPPh2Mn(CO)2Cp). 2. CpMn(CO)2 (π-HC≡CPPh2Mn(CO)2Cp rearranged under the influence of PhLi to the new η1-vinylidene complex Cp(OC)2Mn=CCHPPh2Mn(CO)2Cp. 3. Reaction of CpMh(CO)2PPh2C≡CR (where R=H, Ph) with Co2(CO)8 gave the new heteronuclear complexes Co2(CO)6 (η4-RC≡CPPh2Mn(CO)2Cp).