Photochemical substitution of a single CO ligand of CpFe(CO)2SeC(Y)Y′Ar [(Y)Y′ = (O)O, (S)O and (S)S] by EPh3 (E = P, As, Sb)

Abstract

New iron complexes containing selenocarbonato, selenothiocarbonato and selenodithiocarbonato ligands in addition to CO/EPh3 mixed ligands are synthesized and characterized. CpFe(CO)(EPh3)SeC(Y)Y′Ar [(Y)Y′ = (O)O; Ar = C6H5(1). (Y)Y′ = (S)O; Ar = 4-C6H4Cl (2). (Y)Y′ = (S)S; Ar = C6H5 (3). E = P (a), As (b), Sb (c)] are accessible from the reactions of CpFe(CO)2SeC(Y)Y′Ar with EPh3 under photolytic conditions. The new complexes have been characterized by various spectroscopic methods (UV–Vis, IR, 1H-, 31P-, 13C-, 77Se-NMR) and elemental analysis. The determined structure of CpFe(CO)(AsPh3)SeC(O)OC6H5(1b) has been farther supported by single-crystal X-ray crystal structure analysis.