A Novel Dinuclear Copper(II) Complex Molecule: Synthesis and Crystal Structure of Cu2(phen)2(H2O)2(C5H6O4)2 with phen = 1,10-phenanthroline

Abstract

Blue crystals of Cu2(phen)2(H2O)2(C5H6O4)2 were obtained from a CH3OH–H2O solution containing CuCl2, 1,10-phenanthroline (phen), glutaric acid and Na2CO3. The crystal structure (monoclinic, P21/c (no. 14), a = 10.271(1), b = 10.595(1), c = 15.585(1) Å, β = 107.105(3)°, Z = 2, R = 0.0328, wR2 = 0.1027 for 3376 observed reflections (F ≥ 2σ(F ) out of 3728 unique reflections) is built up of dinuclear Cu2(phen)2(H2O)2(C5H6O4)2 complex molecules centered at inversion centers. The Cu atoms are square-pyramidally coordinated by two nitrogen atoms of one bidentate chelating phen ligand and three oxygen atoms from two bridging glutarate anions and one axial water molecule (d(Cu–N) = 2.018(2), 2.024(2) Å; basal d(Cu–O) = 1.949(2), 1.956(2) Å; axial d(Cu–O) = 2.382(2) Å). Through the π-π stacking interactions extending in a direction, the complex molecules are interlinked into 2 D layers parallel to the ac plane. The resultant 2 D layers are held together by hydrogen bonds between water molecules and uncoordinated carboxyl oxygen atoms.